Saudin

| UNII_Ref = | UNII = 9X6I4D5FVQ | PubChem = 6917902 | SMILES = C[C@@H]1C2C[C@@]3(O[C@@]4([C@]2([C@@]5(O3)COC(=O)[C@]5(CC4)C)C)OC1=O)C6=COC=C6}} |Section2= |Section3= }}

Saudin is a diterpenoid first isolated from the African flowering plant ''Cluytia richardiana''.

Saudin has shown a hypoglycemic effect in an rodent model experiment.

Because of the unusual chemical structure and its potential biological activity, there has been research aimed at its total synthesis. Provided by Wikipedia