Refinement of the crystal structure of aquabis(2,2′-bipyridine)- bis(terephtalato)dicopper(II), Cu2(H2O)(C10H8N2)2(C8H4O4)2
C36H26Cu2N4O9, monoclinic, P121/c1 (no. 14), a = 13.732(3) Å, b = 17.188(3) Å, c = 14.127(3) Å, β = 104.57(3)°, V = 3227.1 Å3, Z = 4, Rgt(F) = 0.032, wRref(F2) = 0.089, T = 293 K.
| Main Author: | |
|---|---|
| Format: | Article |
| Language: | English |
| Published: |
De Gruyter
2006-09-01
|
| Series: | Zeitschrift für Kristallographie - New Crystal Structures |
| Online Access: | https://doi.org/10.1524/ncrs.2006.0121 |